EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CCC(O)/C=C\C=C/C/C=C/C=C/C=C/C(O)C(O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-17(21)13-10-8-6-4-3-5-7-9-11-14-18(22)19(23)15-12-16-20(24)25/h3,5-11,13-14,17-19,21-23H,2,4,12,15-16H2,1H3,(H,24,25)/b5-3+,8-6-,9-7+,13-10-,14-11+ |
| InChIKey | JQFGUBLRJFEKMI-JBEGQGOPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,18-TriHEPE (CHEBI:165270) is a HEPE (CHEBI:72799) |
| IUPAC Name |
|---|
| (7E,9E,11E,14Z,16Z)-5,6,18-trihydroxyicosa-7,9,11,14,16-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070042 | LIPID MAPS |