EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O6 |
| Net Charge | 0 |
| Average Mass | 366.454 |
| Monoisotopic Mass | 366.20424 |
| SMILES | O=C(O)CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\C=C\[C@@H](O)CCO |
| InChI | InChI=1S/C20H30O6/c21-16-15-19(24)12-7-3-6-11-17(22)9-4-1-2-5-10-18(23)13-8-14-20(25)26/h1-7,9-10,12,17-19,21-24H,8,11,13-16H2,(H,25,26)/b2-1+,6-3-,9-4+,10-5-,12-7+/t17-,18+,19+/m0/s1 |
| InChIKey | JTGJRDREFMAMJA-MPPNEBGGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-Hydroxy-Resolvin E1 (CHEBI:165269) is a HEPE (CHEBI:72799) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z,16E,18S)-5,12,18,20-tetrahydroxyicosa-6,8,10,14,16-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03140008 | LIPID MAPS |