EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | CC[C@H](O)/C=C/C=C\CC(=O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H28O5/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25/h3-9,11-13,17,19,21,23H,2,10,14-16H2,1H3,(H,24,25)/b4-3+,9-5-,11-8+,12-6+,13-7-/t17-,19+/m0/s1 |
| InChIKey | IEJXJLXCFNXYAY-IFAPNEAUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-Oxo-Resolvin E1 (CHEBI:165264) is a HEPE (CHEBI:72799) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,14Z,16E,18S)-5,18-dihydroxy-12-oxoicosa-6,8,10,14,16-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03140010 | LIPID MAPS |