EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6Cl2O3 |
| Net Charge | 0 |
| Average Mass | 221.039 |
| Monoisotopic Mass | 219.96940 |
| SMILES | O=C(O)C(Cl)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6Cl2O3/c9-5-1-3-6(4-2-5)13-7(10)8(11)12/h1-4,7H,(H,11,12) |
| InChIKey | HXKWSTRRCHTUEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-Dichlorophenoxyaceticacid (CHEBI:165232) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-chloro-2-(4-chlorophenoxy)acetic acid |