EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O4 |
| Net Charge | 0 |
| Average Mass | 466.662 |
| Monoisotopic Mass | 466.30831 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)OC)CC[C@]1(C)CC[C@]1(C)C3=CCc4c(cc(O)c(O)c4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C30H42O4/c1-18-19-8-9-22-28(4,20(19)16-21(31)24(18)32)13-15-30(6)23-17-27(3,25(33)34-7)11-10-26(23,2)12-14-29(22,30)5/h9,16,23,31-32H,8,10-15,17H2,1-7H3/t23-,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | GAPWCQHXCIXKLV-WXPPGMDDSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pristimerol (CHEBI:165224) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| methyl (2R,4aS,6aS,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 23149271 | ChemSpider |