EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H2Br4O2 |
| Net Charge | 0 |
| Average Mass | 437.707 |
| Monoisotopic Mass | 433.67883 |
| SMILES | O=C(O)c1cc(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C7H2Br4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H,12,13) |
| InChIKey | KVILQONZZZERSG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4,5-Tetrabromobenzoic acid (CHEBI:165216) is a benzoic acids (CHEBI:22723) |
| 2,3,4,5-Tetrabromobenzoic acid (CHEBI:165216) is a organohalogen compound (CHEBI:17792) |
| IUPAC Name |
|---|
| 2,3,4,5-tetrabromobenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10722651 | ChemSpider |