EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O3 |
| Net Charge | -1 |
| Average Mass | 151.141 |
| Monoisotopic Mass | 151.04007 |
| SMILES | Cc1cc([O-])ccc1C(=O)O |
| InChI | InChI=1S/C8H8O3/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,9H,1H3,(H,10,11)/p-1 |
| InChIKey | BBMFSGOFUHEVNP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl-4-hydroxybenzoate (CHEBI:165213) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 4-carboxy-3-methylphenolate |
| Manual Xrefs | Databases |
|---|---|
| 13344004 | ChemSpider |