EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CCCCC(CC)COC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H22O4/c1-3-5-6-12(4-2)11-20-16(19)14-9-7-13(8-10-14)15(17)18/h7-10,12H,3-6,11H2,1-2H3,(H,17,18) |
| InChIKey | HRUJAEJKCNCOGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mono-(2-ethylhexyl) terephthalate (CHEBI:165208) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| 4-(2-ethylhexoxycarbonyl)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15062648 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:155603-50-2 | ChemIDplus |