EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | CCC(CCCC(=O)O)COC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H20O6/c1-2-11(4-3-5-14(17)18)10-22-16(21)13-8-6-12(7-9-13)15(19)20/h6-9,11H,2-5,10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | BIQPFHSSQDGFTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mono-2-ethyl-5-carboxypentyl terephthalate (CHEBI:165207) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| 4-(5-carboxy-2-ethylpentoxy)carbonylbenzoic acid |