EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3 |
| Net Charge | 0 |
| Average Mass | 179.175 |
| Monoisotopic Mass | 179.05824 |
| SMILES | COC(=O)c1ccccc1NC=O |
| InChI | InChI=1S/C9H9NO3/c1-13-9(12)7-4-2-3-5-8(7)10-6-11/h2-6H,1H3,(H,10,11) |
| InChIKey | HRNPZFOYXWWMFL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl n-formylanthranilate (CHEBI:165204) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| methyl 2-ormamidobenzoate |
| Manual Xrefs | Databases |
|---|---|
| 142638 | ChemSpider |
| HMDB0032398 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:41270-80-8 | ChemIDplus |