EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O8 |
| Net Charge | 0 |
| Average Mass | 418.402 |
| Monoisotopic Mass | 418.13762 |
| SMILES | O=C(NCCCC[C@H](NC(=O)c1cccc(O)c1O)C(=O)O)c1cccc(O)c1O |
| InChI | InChI=1S/C20H22N2O8/c23-14-8-3-5-11(16(14)25)18(27)21-10-2-1-7-13(20(29)30)22-19(28)12-6-4-9-15(24)17(12)26/h3-6,8-9,13,23-26H,1-2,7,10H2,(H,21,27)(H,22,28)(H,29,30)/t13-/m0/s1 |
| InChIKey | KQPFLOCEYZIIRD-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2,N6-bis(2,3-Dihydroxybenzoyl)-L-lysine (CHEBI:165185) has functional parent N-benzoylglycine (CHEBI:18089) |
| N2,N6-bis(2,3-Dihydroxybenzoyl)-L-lysine (CHEBI:165185) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| (2S)-2,6-bis[(2,3-dihydroxybenzoyl)amino]hexanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:23369-85-9 | ChemIDplus |