EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:165184 - 2-Aminohippuric acid
| Formula | C9H10N2O3 |
| Net Charge | 0 |
| Average Mass | 194.190 |
| Monoisotopic Mass | 194.06914 |
| SMILES | Nc1ccccc1C(=O)NCC(=O)O |
| InChI | InChI=1S/C9H10N2O3/c10-7-4-2-1-3-6(7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13) |
| InChIKey | DEFPNMKDESPGBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Aminohippuric acid (CHEBI:165184) has functional parent N-benzoylglycine (CHEBI:18089) |
| 2-Aminohippuric acid (CHEBI:165184) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[(2-aminobenzoyl)amino]acetic acid |