EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O4 |
| Net Charge | 0 |
| Average Mass | 260.249 |
| Monoisotopic Mass | 260.07971 |
| SMILES | O=C(O)C1Cc2c(nc3ccccc23)C(C(=O)O)N1 |
| InChI | InChI=1S/C13H12N2O4/c16-12(17)9-5-7-6-3-1-2-4-8(6)14-10(7)11(15-9)13(18)19/h1-4,9,11,14-15H,5H2,(H,16,17)(H,18,19) |
| InChIKey | ZWMZDKZTZLGVRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,4-Tetrahydro-beta-carboline-1,3-dicarboxylic acid (CHEBI:165178) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1,3-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032102 | HMDB |
| 133583 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:59132-30-8 | ChemIDplus |