EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O2 |
| Net Charge | 0 |
| Average Mass | 310.397 |
| Monoisotopic Mass | 310.16813 |
| SMILES | C=CC1CN2CCC1CC2[C@H](O)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C19H22N2O2/c1-2-12-11-21-8-6-13(12)9-18(21)19(23)15-5-7-20-17-4-3-14(22)10-16(15)17/h2-5,7,10,12-13,18-19,22-23H,1,6,8-9,11H2/t12?,13?,18?,19-/m1/s1 |
| InChIKey | VJFMSYZSFUWQPZ-BXJNULTDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-Desmethylquinidine (CHEBI:165176) is a cinchona alkaloid (CHEBI:51323) |
| IUPAC Name |
|---|
| 4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-ol |
| Manual Xrefs | Databases |
|---|---|
| 9762403 | ChemSpider |