EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35N3 |
| Net Charge | 0 |
| Average Mass | 329.532 |
| Monoisotopic Mass | 329.28310 |
| SMILES | [H][C@]12CCCN3CN4CCCC[C@]4([H])[C@@]4(CN5CCCC[C@]5([H])[C@]([H])(C1)C4)C32 |
| InChI | InChI=1S/C21H35N3/c1-3-9-22-14-21-13-17(18(22)7-1)12-16-6-5-11-24(20(16)21)15-23-10-4-2-8-19(21)23/h16-20H,1-15H2/t16-,17+,18+,19+,20?,21+/m0/s1 |
| InChIKey | GFDFZTFQPIBNSQ-QPUJYEMXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Homoormosanine (CHEBI:165173) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (1R,2R,13S,15R,16R,23R)-7,9,21-triazahexacyclo[11.9.1.11,15.02,7.09,23.016,21]tetracosane |