EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33N3O5 |
| Net Charge | 0 |
| Average Mass | 407.511 |
| Monoisotopic Mass | 407.24202 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C21H33N3O5/c1-5-13(4)18(20(27)23-17(21(28)29)10-12(2)3)24-19(26)16(22)11-14-6-8-15(25)9-7-14/h6-9,12-13,16-18,25H,5,10-11,22H2,1-4H3,(H,23,27)(H,24,26)(H,28,29)/t13-,16-,17-,18-/m0/s1 |
| InChIKey | HVPPEXXUDXAPOM-MGHWNKPDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Ile-Leu (CHEBI:165121) has functional parent L-isoleucine (CHEBI:17191) |
| Tyr-Ile-Leu (CHEBI:165121) has functional parent L-leucine (CHEBI:15603) |
| Tyr-Ile-Leu (CHEBI:165121) has functional parent L-tyrosine (CHEBI:17895) |
| Tyr-Ile-Leu (CHEBI:165121) is a tripeptide (CHEBI:47923) |
| Tyr-Ile-Leu (CHEBI:165121) is tautomer of Tyr-Ile-Leu zwitterion (CHEBI:190707) |
| Incoming Relation(s) |
| Tyr-Ile-Leu zwitterion (CHEBI:190707) is tautomer of Tyr-Ile-Leu (CHEBI:165121) |
| IUPAC Name |
|---|
| L-tyrosyl-L-isoleucyl-L-leucine |
| Synonyms | Source |
|---|---|
| H-Tyr-Ile-Leu-OH | ChEBI |
| neurotensin (11-13) | FooDB |
| neurotensin 11-13 | FooDB |
| neurotensin fragment 11-13 | FooDB |
| L-Tyr-L-Ile-L-Leu | ChEBI |
| tyrosylisoleucylleucine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23144810 | ChemSpider |
| FDB029252 | FooDB |
| HMDB0013024 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:60482-98-6 | ChEBI |
| Citations |
|---|