EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O8S |
| Net Charge | 0 |
| Average Mass | 442.530 |
| Monoisotopic Mass | 442.16614 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COS(=O)(=O)O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H30O8S/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25H,3-8,10-11H2,1-2H3,(H,26,27,28)/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | JOVLCJDINAUYJW-VWUMJDOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8650705) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortisol 21-sulfate (CHEBI:16473) has role human metabolite (CHEBI:77746) |
| cortisol 21-sulfate (CHEBI:16473) is a 11β-hydroxy steroid (CHEBI:35346) |
| cortisol 21-sulfate (CHEBI:16473) is a 17α-hydroxy steroid (CHEBI:35342) |
| cortisol 21-sulfate (CHEBI:16473) is a 20-oxo steroid (CHEBI:36885) |
| cortisol 21-sulfate (CHEBI:16473) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cortisol 21-sulfate (CHEBI:16473) is a cortisol ester (CHEBI:23396) |
| cortisol 21-sulfate (CHEBI:16473) is a steroid sulfate (CHEBI:16158) |
| cortisol 21-sulfate (CHEBI:16473) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| cortisol 21-sulfate (CHEBI:16473) is conjugate acid of cortisol 21-sulfate(1−) (CHEBI:57782) |
| Incoming Relation(s) |
| cortisol 21-sulfate(1−) (CHEBI:57782) is conjugate base of cortisol 21-sulfate (CHEBI:16473) |
| IUPAC Name |
|---|
| 11β,17-dihydroxy-3,20-dioxopregn-4-en-21-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 11,17-Dihydroxy-4-pregnene-3,20-dione-21-yl-sulfate | ChemIDplus |
| (11beta)-11,17-Dihydroxy-21-(sulfooxy)pregn-4-ene-3,20-dione | ChemIDplus |
| Cortisol 21-sulfate | KEGG COMPOUND |
| Cortisol-21-sulfate | ChemIDplus |
| Citations |
|---|