EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O |
| Net Charge | 0 |
| Average Mass | 86.134 |
| Monoisotopic Mass | 86.07316 |
| SMILES | CCCC(C)=O |
| InChI | InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
| InChIKey | XNLICIUVMPYHGG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentan-2-one (CHEBI:16472) has role plant metabolite (CHEBI:76924) |
| pentan-2-one (CHEBI:16472) is a methyl ketone (CHEBI:51867) |
| pentan-2-one (CHEBI:16472) is a pentanone (CHEBI:25892) |
| Incoming Relation(s) |
| 1-hydroxy-4-methylpentan-2-one (CHEBI:195499) has functional parent pentan-2-one (CHEBI:16472) |
| IUPAC Name |
|---|
| pentan-2-one |
| Synonyms | Source |
|---|---|
| Pentan-2-one | KEGG COMPOUND |
| 2-Pentanone | KEGG COMPOUND |
| Methyl propyl ketone | KEGG COMPOUND |
| 2-pentanone | ChEBI |
| UniProt Name | Source |
|---|---|
| pentan-2-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01949 | KEGG COMPOUND |
| C01949 | KEGG COMPOUND |
| LMFA12000003 | LIPID MAPS |
| Pentan-2-one | Wikipedia |
| PENTAN-2-ONE | MetaCyc |
| HMDB0034235 | HMDB |
| PNH | PDBeChem |
| Citations |
|---|