EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO5S |
| Net Charge | 0 |
| Average Mass | 197.212 |
| Monoisotopic Mass | 197.03579 |
| SMILES | C[C@@H](NCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C5H11NO5S/c1-4(5(7)8)6-2-3-12(9,10)11/h4,6H,2-3H2,1H3,(H,7,8)(H,9,10,11)/t4-/m1/s1 |
| InChIKey | VHYQDLYSULDZSO-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tauropine (CHEBI:16461) has functional parent taurine (CHEBI:15891) |
| tauropine (CHEBI:16461) is a D-alanine derivative (CHEBI:83944) |
| tauropine (CHEBI:16461) is a D-α-amino acid (CHEBI:16733) |
| tauropine (CHEBI:16461) is a organosulfonic acid (CHEBI:33551) |
| tauropine (CHEBI:16461) is conjugate acid of tauropinate(1−) (CHEBI:57779) |
| Incoming Relation(s) |
| tauropinate(1−) (CHEBI:57779) is conjugate base of tauropine (CHEBI:16461) |
| IUPAC Name |
|---|
| N-(2-sulfoethyl)-D-alanine |
| Synonyms | Source |
|---|---|
| N-(1-carboxyethyl)taurine | ChemIDplus |
| N2-(D-1-carboxyethyl)-2-aminoethanesulfonate | IUBMB |
| N2-(D-1-Carboxyethyl)taurine | KEGG COMPOUND |
| rhodoic acid | ChemIDplus |
| Tauropine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01616 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:33497-79-9 | KEGG COMPOUND |
| CAS:33497-79-9 | ChemIDplus |