EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | CN[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-7-4(6(10)11)2-3-5(8)9/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | XLBVNMSMFQMKEY-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS1) | ||
| - | DOI (10.1007/s11306-014-0642-1) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-L-glutamic acid (CHEBI:16440) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| N-methyl-L-glutamic acid (CHEBI:16440) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| N-methyl-L-glutamic acid (CHEBI:16440) is a methyl-L-glutamic acid (CHEBI:149778) |
| N-methyl-L-glutamic acid (CHEBI:16440) is conjugate acid of N-methyl-L-glutamate(1−) (CHEBI:29083) |
| Incoming Relation(s) |
| N-methyl-L-glutamate(1−) (CHEBI:29083) is conjugate base of N-methyl-L-glutamic acid (CHEBI:16440) |
| IUPAC Name |
|---|
| N-methyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-(methylamino)pentanedioic acid | ChEBI |
| N-methylglutamic acid | ChEBI |
| N-methyl-L-glutamic acid | ChEBI |
| N-Methyl-L-glutamic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01046 | KEGG COMPOUND |
| C01046 | KEGG COMPOUND |
| N-Methyl-L-glutamic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2357675 | Reaxys |
| CAS:35989-16-3 | ChemIDplus |
| Citations |
|---|