EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)C1CCC2(C)OC2C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3 |
| InChIKey | CCEFMUBVSUDRLG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| limonene 1,2-epoxide (CHEBI:16431) has role plant metabolite (CHEBI:76924) |
| limonene 1,2-epoxide (CHEBI:16431) is a epoxide (CHEBI:32955) |
| limonene 1,2-epoxide (CHEBI:16431) is a limonene monoterpenoid (CHEBI:25040) |
| Incoming Relation(s) |
| (4R)-limonene 1,2-epoxide (CHEBI:35672) is a limonene 1,2-epoxide (CHEBI:16431) |
| IUPAC Names |
|---|
| 1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane |
| 1,2-epoxy-p-menth-8-ene |
| Synonyms | Source |
|---|---|
| 4-isopropenyl-1-methyl-7-oxabicyclo[4.1.0]heptane | NIST Chemistry WebBook |
| limonene 1,2-oxide | NIST Chemistry WebBook |
| limonene 1,2-epoxide | NIST Chemistry WebBook |
| 1,2-epoxylimonene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| limonene 1,2-epoxide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035158 | HMDB |
| Citations |
|---|