EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | CCCCCC#CC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b10-9- |
| InChIKey | SAOSKFBYQJLQOS-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-octadec-9-en-12-ynoic acid (CHEBI:16423) is a octadecenynoic acid (CHEBI:25635) |
| (9Z)-octadec-9-en-12-ynoic acid (CHEBI:16423) is conjugate acid of crepenynate (CHEBI:14030) |
| Incoming Relation(s) |
| (9Z)-octadec-9-en-12-ynoyl-containing glycerolipid (CHEBI:88260) has functional parent (9Z)-octadec-9-en-12-ynoic acid (CHEBI:16423) |
| crepenynate (CHEBI:14030) is conjugate base of (9Z)-octadec-9-en-12-ynoic acid (CHEBI:16423) |
| (9Z)-octadec-9-en-12-ynoyl group (CHEBI:86295) is substituent group from (9Z)-octadec-9-en-12-ynoic acid (CHEBI:16423) |
| IUPAC Name |
|---|
| (9Z)-octadec-9-en-12-ynoic acid |
| Synonyms | Source |
|---|---|
| (Z)-9-Octadecen-12-ynoic acid | KEGG COMPOUND |
| Crepenynic acid | KEGG COMPOUND |
| cis-9-Octadecen-12-ynoic acid | ChemIDplus |
| Crepenynsäure | ChEBI |
| cis-Octadec-9-en-12-in-1-säure | ChEBI |
| 9c12a-18:2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07289 | KEGG COMPOUND |
| LMFA01030742 | LIPID MAPS |
| C00001278 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1911942 | Reaxys |
| CAS:2277-31-8 | KEGG COMPOUND |
| CAS:2277-31-8 | ChemIDplus |
| Citations |
|---|