EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO4 |
| Net Charge | -2 |
| Average Mass | 145.114 |
| Monoisotopic Mass | 145.03860 |
| SMILES | C[C@H](C(=O)[O-])[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/p-2/t2-,3-/m0/s1 |
| InChIKey | LXRUAYBIUSUULX-HRFVKAFMSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| threo-3-methyl-L-aspartate(2−) (CHEBI:16378) is a dicarboxylic acid dianion (CHEBI:28965) |
| threo-3-methyl-L-aspartate(2−) (CHEBI:16378) is conjugate base of threo-3-methyl-L-aspartate(1−) (CHEBI:58724) |
| Incoming Relation(s) |
| threo-3-methyl-L-aspartate(1−) (CHEBI:58724) is conjugate acid of threo-3-methyl-L-aspartate(2−) (CHEBI:16378) |
| IUPAC Names |
|---|
| (2S,3S)-2-amino-3-methylbutanedioate |
| (3S)-3-methyl-L-aspartate |