EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O3 |
| Net Charge | 0 |
| Average Mass | 156.141 |
| Monoisotopic Mass | 156.05349 |
| SMILES | O=C(O)[C@@H](O)Cc1cncn1 |
| InChI | InChI=1S/C6H8N2O3/c9-5(6(10)11)1-4-2-7-3-8-4/h2-3,5,9H,1H2,(H,7,8)(H,10,11)/t5-/m0/s1 |
| InChIKey | ACZFBYCNAVEFLC-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-(imidazol-5-yl)lactic acid (CHEBI:16373) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (S)-3-(imidazol-5-yl)lactic acid (CHEBI:16373) is a 3-(imidazol-5-yl)lactic acid (CHEBI:27487) |
| (S)-3-(imidazol-5-yl)lactic acid (CHEBI:16373) is conjugate acid of (S)-3-(imidazol-5-yl)lactate (CHEBI:57752) |
| Incoming Relation(s) |
| (S)-3-(imidazol-5-yl)lactate (CHEBI:57752) is conjugate base of (S)-3-(imidazol-5-yl)lactic acid (CHEBI:16373) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| (S)-3-(imidazol-5-yl)lactate | ChEBI |
| (S)-3-(Imidazol-5-yl)lactate | KEGG COMPOUND |
| L-β-imidazolelactic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03817 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6503796 | Beilstein |