EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N3O14P2R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 504.257 |
| Monoisotopic Mass (excl. R groups) | 504.04205 |
| SMILES | *C(=O)OC[C@@H](O)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-acylglycerol (CHEBI:16371) is a CDP-glycerols (CHEBI:35774) |
| CDP-acylglycerol (CHEBI:16371) is conjugate acid of CDP-acylglycerol(2−) (CHEBI:57751) |
| Incoming Relation(s) |
| CDP-acylglycerol(2−) (CHEBI:57751) is conjugate base of CDP-acylglycerol (CHEBI:16371) |
| IUPAC Name |
|---|
| 5'-O-[{[{[(2R)-3-acyloxy-2-hydroxypropyl]oxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]cytidine |
| Synonyms | Source |
|---|---|
| 1-Acyl-sn-glycero-3-cytidine-5'-diphosphate | KEGG COMPOUND |
| CDPacylglycerol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02255 | KEGG COMPOUND |
| LMGP13050000 | LIPID MAPS |