EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | [H][C@@]12CC[C@@]3(C)C=CC(=O)C(C)=C3[C@@]1([H])OC(=O)[C@H]2C |
| InChI | InChI=1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1 |
| InChIKey | XJHDMGJURBVLLE-BOCCBSBMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-santonin (CHEBI:16363) has role plant metabolite (CHEBI:76924) |
| α-santonin (CHEBI:16363) is a botanical anti-fungal agent (CHEBI:86494) |
| α-santonin (CHEBI:16363) is a santonin (CHEBI:26604) |
| Incoming Relation(s) |
| 1,2-dihydro-α-santonin (CHEBI:16850) has functional parent α-santonin (CHEBI:16363) |
| IUPAC Name |
|---|
| (3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,5,5a,9b-tetrahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione |
| Synonyms | Source |
|---|---|
| (11S)-6α-hydroxy-3-oxoeudesma-1,4-dien-12-oic acid γ-lactone | NIST Chemistry WebBook |
| 6α-hydroxy-3-oxo-11-epiisoeusantona-1,4-dienic acid γ-lactone | NIST Chemistry WebBook |
| alpha-Santonin | KEGG COMPOUND |
| (−)-Santonin | NIST Chemistry WebBook |
| Santoninic anhydride | NIST Chemistry WebBook |
| (−)-α-Santonin | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| α-santonin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| ALPHA-SANTONIN | MetaCyc |
| C00003364 | KNApSAcK |
| C02206 | KEGG COMPOUND |
| D00154 | KEGG DRUG |
| LMPR0103190001 | LIPID MAPS |
| LSM-6627 | LINCS |
| Santonin | Wikipedia |
| Citations |
|---|