EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | [H][C@@]12CC[C@@]3(C)C=CC(=O)C(C)=C3[C@@]1([H])OC(=O)[C@H]2C |
| InChI | InChI=1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1 |
| InChIKey | XJHDMGJURBVLLE-BOCCBSBMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-santonin (CHEBI:16363) has role plant metabolite (CHEBI:76924) |
| α-santonin (CHEBI:16363) is a botanical anti-fungal agent (CHEBI:86494) |
| α-santonin (CHEBI:16363) is a santonin (CHEBI:26604) |
| Incoming Relation(s) |
| 1,2-dihydro-α-santonin (CHEBI:16850) has functional parent α-santonin (CHEBI:16363) |
| IUPAC Name |
|---|
| (3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,5,5a,9b-tetrahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione |
| Synonyms | Source |
|---|---|
| alpha-Santonin | KEGG COMPOUND |
| (−)-α-Santonin | NIST Chemistry WebBook |
| (−)-Santonin | NIST Chemistry WebBook |
| (11S)-6α-hydroxy-3-oxoeudesma-1,4-dien-12-oic acid γ-lactone | NIST Chemistry WebBook |
| Santoninic anhydride | NIST Chemistry WebBook |
| 6α-hydroxy-3-oxo-11-epiisoeusantona-1,4-dienic acid γ-lactone | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| α-santonin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02206 | KEGG COMPOUND |
| LMPR0103190001 | LIPID MAPS |
| ALPHA-SANTONIN | MetaCyc |
| Santonin | Wikipedia |
| D00154 | KEGG DRUG |
| C00003364 | KNApSAcK |
| LSM-6627 | LINCS |
| Citations |
|---|