EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | N[C@@H](Cn1cccn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)4-9-3-1-2-8-9/h1-3,5H,4,7H2,(H,10,11)/t5-/m0/s1 |
| InChIKey | PIGOPELHGLPKLL-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(pyrazol-1-yl)-L-alanine (CHEBI:16357) is a L-alanine derivative (CHEBI:83943) |
| 3-(pyrazol-1-yl)-L-alanine (CHEBI:16357) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-(pyrazol-1-yl)-L-alanine (CHEBI:16357) is tautomer of 3-(pyrazol-1-yl)-L-alanine zwitterion (CHEBI:57747) |
| Incoming Relation(s) |
| 3-(pyrazol-1-yl)-L-alanine zwitterion (CHEBI:57747) is tautomer of 3-(pyrazol-1-yl)-L-alanine (CHEBI:16357) |
| IUPAC Name |
|---|
| 3-(1H-pyrazol-1-yl)-L-alanine |
| Synonyms | Source |
|---|---|
| 3-(pyrazol-1-yl)-L-alanine | ChEBI |
| 3-(Pyrazol-1-yl)-L-alanine | KEGG COMPOUND |
| beta-pyrazol-1-ylalanine | ChEBI |
| beta-Pyrazol-1-ylalanine | KEGG COMPOUND |