EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24NO5 |
| Net Charge | +1 |
| Average Mass | 310.370 |
| Monoisotopic Mass | 310.16490 |
| SMILES | COc1cc(/C=C/C(=O)OCC[N+](C)(C)C)cc(OC)c1O |
| InChI | InChI=1S/C16H23NO5/c1-17(2,3)8-9-22-15(18)7-6-12-10-13(20-4)16(19)14(11-12)21-5/h6-7,10-11H,8-9H2,1-5H3/p+1 |
| InChIKey | HUJXHFRXWWGYQH-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | - | PubMed (23030806) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinapine (CHEBI:16353) has functional parent trans-sinapic acid (CHEBI:15714) |
| sinapine (CHEBI:16353) has role antioxidant (CHEBI:22586) |
| sinapine (CHEBI:16353) has role photosynthetic electron-transport chain inhibitor (CHEBI:26087) |
| sinapine (CHEBI:16353) has role plant metabolite (CHEBI:76924) |
| sinapine (CHEBI:16353) is a acylcholine (CHEBI:35287) |
| IUPAC Name |
|---|
| 2-[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]-N,N,N-trimethylethanaminium |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-3,5-dimethoxycinnamoyloxy)-N,N,N-trimethylethanaminium | ChEBI |
| O-sinapoylcholine | ChEBI |
| Sinapine | KEGG COMPOUND |
| Sinapoylcholine | KEGG COMPOUND |
| Sinapoylcholine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| O-sinapoylcholine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4933491 | Reaxys |
| CAS:18696-26-9 | KEGG COMPOUND |
| CAS:18696-26-9 | ChemIDplus |
| Citations |
|---|