EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7N3O3 |
| Net Charge | 0 |
| Average Mass | 133.107 |
| Monoisotopic Mass | 133.04874 |
| SMILES | NC(=O)NC(N)C(=O)O |
| InChI | InChI=1S/C3H7N3O3/c4-1(2(7)8)6-3(5)9/h1H,4H2,(H,7,8)(H3,5,6,9) |
| InChIKey | VTFWFHCECSOPSX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ureidoglycine (CHEBI:16282) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-ureidoglycine (CHEBI:16282) is a ureas (CHEBI:47857) |
| 2-ureidoglycine (CHEBI:16282) is tautomer of 2-ureidoglycine zwitterion (CHEBI:57714) |
| Incoming Relation(s) |
| (S)-2-ureidoglycine (CHEBI:59945) is a 2-ureidoglycine (CHEBI:16282) |
| 2-ureidoglycine zwitterion (CHEBI:57714) is tautomer of 2-ureidoglycine (CHEBI:16282) |
| IUPAC Name |
|---|
| 2-(carbamoylamino)glycine |
| Synonyms | Source |
|---|---|
| Ureidoglycine | KEGG COMPOUND |
| amino(carbamoylamino)acetic acid | IUPAC |
| (±)-2-ureidoglycine | ChEBI |
| (±)-2-(carbamoylamino)glycine | ChEBI |
| (±)-amino(carbamoylamino)acetic acid | ChEBI |