EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11O8P |
| Net Charge | 0 |
| Average Mass | 230.109 |
| Monoisotopic Mass | 230.01915 |
| SMILES | [H]C(=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4-,5+/m1/s1 |
| InChIKey | PPQRONHOSHZGFQ-WDCZJNDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (12805358) | ||
| - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-D-arabinose 5-phosphate (CHEBI:16241) is a D-arabinose 5-phosphate (CHEBI:79058) |
| aldehydo-D-arabinose 5-phosphate (CHEBI:16241) is conjugate acid of aldehydo-D-arabinose 5-phosphate(2−) (CHEBI:57693) |
| Incoming Relation(s) |
| aldehydo-D-arabinose 5-phosphate(2−) (CHEBI:57693) is conjugate base of aldehydo-D-arabinose 5-phosphate (CHEBI:16241) |
| IUPAC Name |
|---|
| D-arabinose 5-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 5-O-phosphono-D-arabinose | IUPAC |
| D-A-5-P | ChemIDplus |
| D-Arabinose 5-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| ARABINOSE-5P | MetaCyc |
| C01112 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728060 | Reaxys |
| CAS:13137-52-5 | ChemIDplus |
| CAS:13137-52-5 | KEGG COMPOUND |
| Citations |
|---|