EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO4 |
| Net Charge | 0 |
| Average Mass | 325.364 |
| Monoisotopic Mass | 325.13141 |
| SMILES | [H][C@@]12Cc3ccc4c(c3CN1CCc1cc(OC)c(O)cc12)OCO4 |
| InChI | InChI=1S/C19H19NO4/c1-22-18-7-12-4-5-20-9-14-11(2-3-17-19(14)24-10-23-17)6-15(20)13(12)8-16(18)21/h2-3,7-8,15,21H,4-6,9-10H2,1H3/t15-/m0/s1 |
| InChIKey | FVXCQULKSPVRPK-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-cheilanthifoline (CHEBI:16233) is a berberine alkaloid (CHEBI:22754) |
| (S)-cheilanthifoline (CHEBI:16233) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (6aS)-9-methoxy-6,11,12,14-tetrahydro-2H,6aH-[1,3]dioxolo[4,5-h]isoquino[2,1-b]isoquinolin-8-ol |
| Synonyms | Source |
|---|---|
| (S)-Cheilanthifoline | KEGG COMPOUND |
| (6aS)-6,6a,11,14-Tetrahydro-8-methoxy-12H-benzo[a]-1,3-benzodioxolo[4,5-g]quinolizim-9-ol | KEGG COMPOUND |
| (S)-cheilanthifoline | ChEBI |
| (6aS)-6,6a,11,14-tetrahydro-8-methoxy-12H-benzo[a]-1,3-benzodioxolo[4,5-g]quinolizim-9-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-cheilanthifoline | UniProt |