EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O8 |
| Net Charge | 0 |
| Average Mass | 470.518 |
| Monoisotopic Mass | 470.19407 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@H]4O[C@]43[C@]1(C)C(=O)C[C@@]1([H])C(C)(C)O[C@@]3([H])CC(=O)OC[C@@]213 |
| InChI | InChI=1S/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
| InChIKey | KBDSLGBFQAGHBE-MSGMIQHVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | inhibitor A substance that diminishes the rate of a chemical reaction. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| limonin (CHEBI:16226) has role inhibitor (CHEBI:35222) |
| limonin (CHEBI:16226) has role metabolite (CHEBI:25212) |
| limonin (CHEBI:16226) has role volatile oil component (CHEBI:27311) |
| limonin (CHEBI:16226) is a epoxide (CHEBI:32955) |
| limonin (CHEBI:16226) is a furans (CHEBI:24129) |
| limonin (CHEBI:16226) is a hexacyclic triterpenoid (CHEBI:70994) |
| limonin (CHEBI:16226) is a lactone (CHEBI:25000) |
| limonin (CHEBI:16226) is a limonoid (CHEBI:39434) |
| limonin (CHEBI:16226) is a organic heterohexacyclic compound (CHEBI:51914) |
| Incoming Relation(s) |
| deoxylimonoic acid (CHEBI:17133) has functional parent limonin (CHEBI:16226) |
| limonin 17-β-D-glucoside (CHEBI:16063) has functional parent limonin (CHEBI:16226) |
| IUPAC Name |
|---|
| (4aS,6aR,8aR,8bR,9aS,12R,12aS,14aR,14bR)-12-(3-furyl)-6,6,8a,12a-tetramethyldecahydro-3H-oxireno[d]pyrano[4',3':3,3a][2]benzofuro[5,4-f]isochromene-3,8,10(6H,9aH)-trione |
| Synonyms | Source |
|---|---|
| 7,16-Dioxo-7,16-dideoxylimondiol | ChemIDplus |
| Citrolimonin | ChemIDplus |
| Dictamnolactone | ChemIDplus |
| Evodin | KEGG COMPOUND |
| Limonin | KEGG COMPOUND |
| Limonoate D-ring-lactone | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Evodia fruit | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| limonin | UniProt |
| Citations |
|---|