EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O5 |
| Net Charge | 0 |
| Average Mass | 284.272 |
| Monoisotopic Mass | 284.11207 |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c2N=CNC[C@H]3O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H16N4O5/c16-2-6-8(18)9(19)11(20-6)15-4-14-7-5(17)1-12-3-13-10(7)15/h3-6,8-9,11,16-19H,1-2H2,(H,12,13)/t5-,6-,8-,9-,11-/m1/s1 |
| InChIKey | YOOVTUPUBVHMPG-LODYRLCVSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.4.4 (adenosine deaminase) inhibitor An EC 3.5.4.* (non-peptide cyclic amidine C-N hydrolase) inhibitor that interferes with the action of adenosine deaminase (EC 3.5.4.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coformycin (CHEBI:16213) has role EC 3.5.4.4 (adenosine deaminase) inhibitor (CHEBI:50445) |
| coformycin (CHEBI:16213) is a coformycins (CHEBI:39304) |
| coformycin (CHEBI:16213) is conjugate base of coformycin(1+) (CHEBI:57682) |
| Incoming Relation(s) |
| coformycin(1+) (CHEBI:57682) is conjugate acid of coformycin (CHEBI:16213) |
| IUPAC Name |
|---|
| (8R)-3-β-D-ribofuranosyl-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol |
| Synonyms | Source |
|---|---|
| Coformycin | KEGG COMPOUND |
| (R)-3,4,7,8-Tetrahydro-3-beta-D-ribofuranosylimidazo(4,5-d)(1,3)diazepin-8-ol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01677 | KEGG COMPOUND |
| COFORMYCIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5609987 | Reaxys |
| CAS:11033-22-0 | KEGG COMPOUND |
| CAS:11033-22-0 | ChemIDplus |
| Citations |
|---|