EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(O)cc(C)cc1C2=O |
| InChI | InChI=1S/C16H12O5/c1-7-3-9-13(11(18)4-7)16(20)14-10(15(9)19)5-8(17)6-12(14)21-2/h3-6,17-18H,1-2H3 |
| InChIKey | UUNPIWCQMVNINR-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| questin (CHEBI:16200) has functional parent emodin (CHEBI:42223) |
| questin (CHEBI:16200) is a dihydroxyanthraquinone (CHEBI:37484) |
| questin (CHEBI:16200) is conjugate acid of questin-2-olate (CHEBI:57676) |
| Incoming Relation(s) |
| questin-2-olate (CHEBI:57676) is conjugate base of questin (CHEBI:16200) |
| IUPAC Name |
|---|
| 1,6-dihydroxy-8-methoxy-3-methylanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| Questin | KEGG COMPOUND |
| 1,6-dihydroxy-3-methyl-8-(methyloxy)anthracene-9,10-dione | IUPAC |
| emodin-8-methyl ether | ChemIDplus |
| 1,6-dihydroxy-8-methoxy-3-methyl-9,10-anthraquinone | IUPAC |
| 3,8-dihydroxy-1-methoxy-6-methylanthracene-9,10-dione | IUBMB |