EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O |
| Net Charge | 0 |
| Average Mass | 384.648 |
| Monoisotopic Mass | 384.33922 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h17-19,22-25H,6-16H2,1-5H3/t19-,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | NYOXRYYXRWJDKP-GYKMGIIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton hieronymi (IPNI:342670-1) | aerial part (BTO:0001658) | PubMed (12943786) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24565079) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholest-4-en-3-one (CHEBI:16175) has role human metabolite (CHEBI:77746) |
| cholest-4-en-3-one (CHEBI:16175) has role plant metabolite (CHEBI:76924) |
| cholest-4-en-3-one (CHEBI:16175) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cholest-4-en-3-one (CHEBI:16175) is a cholestanoid (CHEBI:50401) |
| Incoming Relation(s) |
| 25-hydroxycholest-4-en-3-one (CHEBI:155845) has functional parent cholest-4-en-3-one (CHEBI:16175) |
| 26-hydroxycholest-4-en-3-one (CHEBI:63640) has functional parent cholest-4-en-3-one (CHEBI:16175) |
| 3-ketocholest-4-en-26-al (CHEBI:83746) has functional parent cholest-4-en-3-one (CHEBI:16175) |
| 7α,25-dihydroxy-4-cholesten-3-one (CHEBI:81013) has functional parent cholest-4-en-3-one (CHEBI:16175) |
| IUPAC Name |
|---|
| cholest-4-en-3-one |
| Synonyms | Source |
|---|---|
| 4-cholesten-3-one | ChEBI |
| 4-Cholesten-3-one | KEGG COMPOUND |
| Cholest-4-en-3-one | KEGG COMPOUND |
| Cholestenone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| cholest-4-en-3-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00036093 | KNApSAcK |
| C00599 | KEGG COMPOUND |
| C00599 | KEGG COMPOUND |
| CPD-323 | MetaCyc |
| FDB022319 | FooDB |
| HMDB0000921 | HMDB |
| K2B | PDBeChem |
| LMST01010015 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:601-57-0 | KEGG COMPOUND |
| CAS:601-57-0 | NIST Chemistry WebBook |
| Citations |
|---|