EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16169 - homogentisate
| Formula | C8H7O4 |
| Net Charge | -1 |
| Average Mass | 167.140 |
| Monoisotopic Mass | 167.03498 |
| SMILES | O=C([O-])Cc1cc(O)ccc1O |
| InChI | InChI=1S/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1 |
| InChIKey | IGMNYECMUMZDDF-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homogentisate (CHEBI:16169) has functional parent acetate (CHEBI:30089) |
| homogentisate (CHEBI:16169) has role human metabolite (CHEBI:77746) |
| homogentisate (CHEBI:16169) has role plant metabolite (CHEBI:76924) |
| homogentisate (CHEBI:16169) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| homogentisate (CHEBI:16169) is conjugate base of homogentisic acid (CHEBI:44747) |
| Incoming Relation(s) |
| homogentisic acid (CHEBI:44747) is conjugate acid of homogentisate (CHEBI:16169) |
| IUPAC Name |
|---|
| (2,5-dihydroxyphenyl)acetate |
| UniProt Name | Source |
|---|---|
| homogentisate | UniProt |