EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O2 |
| Net Charge | 0 |
| Average Mass | 148.161 |
| Monoisotopic Mass | 148.05243 |
| SMILES | O=C1CCc2ccccc2O1 |
| InChI | InChI=1S/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2 |
| InChIKey | VMUXSMXIQBNMGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydrocoumarin (CHEBI:16151) has functional parent coumarin (CHEBI:28794) |
| 3,4-dihydrocoumarin (CHEBI:16151) has role plant metabolite (CHEBI:76924) |
| 3,4-dihydrocoumarin (CHEBI:16151) is a chromanone (CHEBI:38763) |
| IUPAC Name |
|---|
| 3,4-dihydro-2H-1-benzopyran-2-one |
| Synonyms | Source |
|---|---|
| Dihydrocoumarin | KEGG COMPOUND |
| 3,4-Dihydrocoumarin | KEGG COMPOUND |
| 3,4-dihydrocoumarin | ChEBI |
| 1,2-benzodihydropyrone | ChemIDplus |
| 2-chromanone | ChemIDplus |
| 2-hydroxydihydrocinnamic acid lactone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3,4-dihydrocoumarin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02274 | KEGG COMPOUND |
| c0397 | UM-BBD |
| DIHYDROCOUMARIN | MetaCyc |
| HMDB0036626 | HMDB |
| Citations |
|---|