EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2O4 |
| Net Charge | 0 |
| Average Mass | 211.000 |
| Monoisotopic Mass | 209.94866 |
| SMILES | O=C(O)CC1(Cl)C=C(Cl)C(=O)O1 |
| InChI | InChI=1S/C6H4Cl2O4/c7-3-1-6(8,2-4(9)10)12-5(3)11/h1H,2H2,(H,9,10) |
| InChIKey | RNYNGUYSDYOCLB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetic acid (CHEBI:16106) is a 5-oxo-2-furylacetic acid (CHEBI:23730) |
| 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetic acid (CHEBI:16106) is a organochlorine compound (CHEBI:36683) |
| 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetic acid (CHEBI:16106) is conjugate acid of 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate (CHEBI:57641) |
| Incoming Relation(s) |
| 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate (CHEBI:57641) is conjugate base of 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetic acid (CHEBI:16106) |
| IUPAC Name |
|---|
| (2,4-dichloro-5-oxo-2,5-dihydrofuran-2-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 2,4-Dichloro-2,5-dihydro-5-oxofuran-2-acetate | KEGG COMPOUND |
| 3,5-Dichloro-2,5-dihydro-2-oxofuran-5-acetate | KEGG COMPOUND |
| 3,5-dichloro-2,5-dihydro-2-oxofuran-5-acetate | ChEBI |