EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O2 |
| Net Charge | 0 |
| Average Mass | 183.211 |
| Monoisotopic Mass | 183.10078 |
| SMILES | CN(C)[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C8H13N3O2/c1-11(2)7(8(12)13)3-6-4-9-5-10-6/h4-5,7H,3H2,1-2H3,(H,9,10)(H,12,13)/t7-/m0/s1 |
| InChIKey | IMOBSLOLPCWZKQ-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα,Nα-dimethyl-L-histidine (CHEBI:16029) has role fungal metabolite (CHEBI:76946) |
| Nα,Nα-dimethyl-L-histidine (CHEBI:16029) is a Nα-methyl-L-histidines (CHEBI:21911) |
| Nα,Nα-dimethyl-L-histidine (CHEBI:16029) is tautomer of Nα,Nα-dimethyl-L-histidine zwitterion (CHEBI:57610) |
| Incoming Relation(s) |
| Nα,Nα-dimethyl-L-histidine zwitterion (CHEBI:57610) is tautomer of Nα,Nα-dimethyl-L-histidine (CHEBI:16029) |
| IUPAC Names |
|---|
| N,N-dimethyl-L-histidine |
| (2S)-2-(dimethylamino)-3-(1H-imidazol-4-yl)propanoic acid |
| Synonym | Source |
|---|---|
| Nalpha,Nalpha-Dimethyl-L-histidine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04259 | KEGG COMPOUND |
| NALPHANALPHA-DIMETHYL-L-HISTIDINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3607906 | Reaxys |
| CAS:24940-57-6 | KEGG COMPOUND |
| Citations |
|---|