EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O |
| Net Charge | 0 |
| Average Mass | 231.299 |
| Monoisotopic Mass | 231.13716 |
| SMILES | Cc1c(N(C)C)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C13H17N3O/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11/h5-9H,1-4H3 |
| InChIKey | RMMXTBMQSGEXHJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminophenazone (CHEBI:160246) has role antipyretic (CHEBI:35493) |
| aminophenazone (CHEBI:160246) has role environmental contaminant (CHEBI:78298) |
| aminophenazone (CHEBI:160246) has role non-narcotic analgesic (CHEBI:35481) |
| aminophenazone (CHEBI:160246) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| aminophenazone (CHEBI:160246) has role xenobiotic (CHEBI:35703) |
| aminophenazone (CHEBI:160246) is a pyrazolone (CHEBI:83328) |
| aminophenazone (CHEBI:160246) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-(dimethylamino)-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |
| INNs | Source |
|---|---|
| aminofenazona | ChemIDplus |
| aminophenazone | KEGG DRUG |
| aminophenazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,5-Dimethyl-4-dimethylamino-2-phenyl-3-pyrazolone | ChemIDplus |
| 1-Phenyl-2,3-dimethyl-4-(dimethylamino)-5-pyrazolone | NIST Chemistry WebBook |
| 1-Phenyl-2,3-dimethyl-4-dimethylaminopyrazol-5-one | ChemIDplus |
| 2,3-Dimethyl-4-dimethylamino-1-phenyl-5-pyrazolone | ChemIDplus |
| 3-Keto-1,5-dimethyl-4-dimethylamino-2-phenyl-2,3-dihydropyrazole | ChemIDplus |
| 4-(Dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 171 | DrugCentral |
| Aminophenazone | Wikipedia |
| C07539 | KEGG COMPOUND |
| D00556 | KEGG DRUG |
| DB01424 | DrugBank |
| HMDB0015493 | HMDB |
| LSM-20000 | LINCS |
| Citations |
|---|