EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O4 |
| Net Charge | 0 |
| Average Mass | 148.118 |
| Monoisotopic Mass | 148.04841 |
| SMILES | NC(=O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H8N2O4/c5-2(3(7)8)1-10-4(6)9/h2H,1,5H2,(H2,6,9)(H,7,8)/t2-/m0/s1 |
| InChIKey | MYFVWSDZEBSNKM-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-carbamoyl-L-serine (CHEBI:15970) is a L-serine derivative (CHEBI:84135) |
| O-carbamoyl-L-serine (CHEBI:15970) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| O-carbamoyl-L-serine (CHEBI:15970) is tautomer of O-carbamoyl-L-serine zwitterion (CHEBI:57594) |
| Incoming Relation(s) |
| O-carbamoyl-L-serine zwitterion (CHEBI:57594) is tautomer of O-carbamoyl-L-serine (CHEBI:15970) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-(carbamoyloxy)propanoic acid |
| O-carbamoyl-L-serine |
| Synonym | Source |
|---|---|
| O-Carbamoyl-L-serine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03015 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:2105-23-9 | KEGG COMPOUND |