EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O5 |
| Net Charge | 0 |
| Average Mass | 182.131 |
| Monoisotopic Mass | 182.02152 |
| SMILES | O=C(O)c1cc(O)cc(=O)c(O)c1 |
| InChI | InChI=1S/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | ANEBWDNUQVPSJT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stipitatic acid (CHEBI:15957) has parent hydride cyclohepta-1,3,5-triene (CHEBI:37519) |
| stipitatic acid (CHEBI:15957) is a monocarboxylic acid (CHEBI:25384) |
| stipitatic acid (CHEBI:15957) is conjugate acid of stipitatate(1−) (CHEBI:77842) |
| stipitatic acid (CHEBI:15957) is conjugate acid of stipitatate(2−) (CHEBI:57587) |
| Incoming Relation(s) |
| stipitatate(1−) (CHEBI:77842) is conjugate base of stipitatic acid (CHEBI:15957) |
| stipitatate(2−) (CHEBI:57587) is conjugate base of stipitatic acid (CHEBI:15957) |
| IUPAC Name |
|---|
| 3,6-dihydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| Stipitatate | KEGG COMPOUND |
| Stipitatic acid | KEGG COMPOUND |