EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13O9P |
| Net Charge | 0 |
| Average Mass | 260.135 |
| Monoisotopic Mass | 260.02972 |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h4-7,9-11H,1-2H2,(H2,12,13,14)/t4-,5-,6-/m1/s1 |
| InChIKey | GSXOAOHZAIYLCY-HSUXUTPPSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-D-fructose 6-phosphate (CHEBI:15946) has functional parent D-fructose (CHEBI:15824) |
| keto-D-fructose 6-phosphate (CHEBI:15946) is a D-fructose 6-phosphate (CHEBI:78697) |
| keto-D-fructose 6-phosphate (CHEBI:15946) is conjugate acid of D-fructose 6-phosphate(2−) (CHEBI:57579) |
| Incoming Relation(s) |
| D-fructose 6-phosphate(2−) (CHEBI:57579) is conjugate base of keto-D-fructose 6-phosphate (CHEBI:15946) |
| IUPAC Name |
|---|
| D-fructose 6-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| D-Fructose 6-phosphate | KEGG COMPOUND |
| D-Fructose 6-phosphoric acid | KEGG COMPOUND |
| Neuberg ester | KEGG COMPOUND |
| Fructose-6-phosphate | ChemIDplus |
| Citations |
|---|