EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H62O16 |
| Net Charge | 0 |
| Average Mass | 822.942 |
| Monoisotopic Mass | 822.40379 |
| SMILES | [H][C@]12C(=O)C=C3[C@]4([H])C[C@@](C)(C(=O)O)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21-,22-,23-,24-,25-,26-,27+,28-,29-,30+,31+,34-,35-,38+,39-,40-,41+,42+/m0/s1 |
| InChIKey | LPLVUJXQOOQHMX-QWBHMCJMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza (ncbitaxon:46347) | - | DOI (10.1021/np100371k) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhizinic acid (CHEBI:15939) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| glycyrrhizinic acid (CHEBI:15939) has role plant metabolite (CHEBI:76924) |
| glycyrrhizinic acid (CHEBI:15939) is a enone (CHEBI:51689) |
| glycyrrhizinic acid (CHEBI:15939) is a glucosiduronic acid (CHEBI:24302) |
| glycyrrhizinic acid (CHEBI:15939) is a pentacyclic triterpenoid (CHEBI:25872) |
| glycyrrhizinic acid (CHEBI:15939) is a tricarboxylic acid (CHEBI:27093) |
| glycyrrhizinic acid (CHEBI:15939) is a triterpenoid saponin (CHEBI:61778) |
| glycyrrhizinic acid (CHEBI:15939) is conjugate acid of glycyrrhizinate(3−) (CHEBI:29807) |
| Incoming Relation(s) |
| glycyrrhizinate(3−) (CHEBI:29807) is conjugate base of glycyrrhizinic acid (CHEBI:15939) |
| IUPAC Name |
|---|
| 30-hydroxy-11,30-dioxoolean-12-en-3β-yl (2-O-β-D-glucopyranosyluronic acid)-α-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| (3β,20β)-20-carboxy-11-oxo-30-norolean-12-en-3-yl-2-O-β-D-glucopyranuronosyl-α-D-glucopyranosiduronic acid | ChemIDplus |
| Glycyrrhizic acid | KEGG COMPOUND |
| Glycyrrhizin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1325 | DrugCentral |
| C02284 | KEGG COMPOUND |
| Glycyrrhizin | Wikipedia |
| GLYCYRRHIZINATE | MetaCyc |
| HMDB0029843 | HMDB |
| LMPR0106150013 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:77922 | Reaxys |
| CAS:1405-86-3 | KEGG COMPOUND |
| CAS:1405-86-3 | ChemIDplus |
| Citations |
|---|