EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O16P2 |
| Net Charge | 0 |
| Average Mass | 536.276 |
| Monoisotopic Mass | 536.04446 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC3OC[C@](O)(CO)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H22N2O16P2/c17-4-14(23)5-28-12(10(14)21)31-34(26,27)32-33(24,25)29-3-6-8(19)9(20)11(30-6)16-2-1-7(18)15-13(16)22/h1-2,6,8-12,17,19-21,23H,3-5H2,(H,24,25)(H,26,27)(H,15,18,22)/t6-,8-,9-,10+,11-,12?,14-/m1/s1 |
| InChIKey | SYVORCSTSYHSPN-NJYNAKMISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-D-apiose (CHEBI:15933) is a UDP-sugar (CHEBI:17297) |
| UDP-D-apiose (CHEBI:15933) is conjugate acid of UDP-D-apiose(2−) (CHEBI:57572) |
| Incoming Relation(s) |
| UDP-α-D-apiose (CHEBI:73886) is a UDP-D-apiose (CHEBI:15933) |
| UDP-D-apiose(2−) (CHEBI:57572) is conjugate base of UDP-D-apiose (CHEBI:15933) |
| IUPAC Name |
|---|
| uridine 5'-{3-[3-C-(hydroxymethyl)-D-erythrofuranosyl] dihydrogen diphosphate} |