EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O3 |
| Net Charge | 0 |
| Average Mass | 224.300 |
| Monoisotopic Mass | 224.14124 |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4-/t10-,11-/m1/s1 |
| InChIKey | GEWDNTWNSAZUDX-WQMVXFAESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-methyl jasmonate (CHEBI:15929) has role jasmonates (CHEBI:24937) |
| (−)-methyl jasmonate (CHEBI:15929) has role plant hormone (CHEBI:37848) |
| (−)-methyl jasmonate (CHEBI:15929) has role plant metabolite (CHEBI:76924) |
| (−)-methyl jasmonate (CHEBI:15929) is a Jasmonate derivatives (CHEBI:167055) |
| (−)-methyl jasmonate (CHEBI:15929) is a jasmonate ester (CHEBI:52464) |
| (−)-methyl jasmonate (CHEBI:15929) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetate |
| Synonyms | Source |
|---|---|
| 3-oxo-2-(2-pentenyl)cyclopentaneacetic acid methyl ester | ChEBI |
| methyl (-)-jasmonate | ChEBI |
| (-)-Methyl jasmonate | KEGG COMPOUND |
| Methyl jasmonate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| methyl (−)-jasmonate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000219 | KNApSAcK |
| C11512 | KEGG COMPOUND |
| CPD1F-2 | MetaCyc |
| HMDB0036583 | HMDB |
| LMFA02020010 | LIPID MAPS |
| Methyl_jasmonate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4232548 | Reaxys |
| CAS:1211-29-6 | KEGG COMPOUND |
| CAS:1211-29-6 | ChemIDplus |
| Citations |
|---|