EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H73NO17 |
| Net Charge | 0 |
| Average Mass | 888.058 |
| Monoisotopic Mass | 887.48785 |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H]1CO[C@@H]1O[C@H](C)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C44H73NO17/c1-11-31-28(20-56-42-38(53)37(52)35(50)24(5)58-42)16-21(2)12-13-29(47)22(3)17-27(14-15-46)39(23(4)30(48)18-32(49)60-31)62-43-36(51)34(45(9)10)40(25(6)59-43)61-33-19-44(8,55)41(54)26(7)57-33/h12-13,15-16,22-28,30-31,33-43,48,50-55H,11,14,17-20H2,1-10H3/b13-12+,21-16+/t22-,23+,24-,25-,26+,27+,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40-,41+,42-,43+,44-/m1/s1 |
| InChIKey | ALZAOGATQMXJKX-UQRCBBHQSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethylmacrocin (CHEBI:15906) has functional parent tylactone (CHEBI:29700) |
| demethylmacrocin (CHEBI:15906) is a aldehyde (CHEBI:17478) |
| demethylmacrocin (CHEBI:15906) is a disaccharide derivative (CHEBI:63353) |
| demethylmacrocin (CHEBI:15906) is a enone (CHEBI:51689) |
| demethylmacrocin (CHEBI:15906) is a leucomycin (CHEBI:25022) |
| demethylmacrocin (CHEBI:15906) is a macrolide antibiotic (CHEBI:25105) |
| demethylmacrocin (CHEBI:15906) is a monosaccharide derivative (CHEBI:63367) |
| demethylmacrocin (CHEBI:15906) is conjugate base of demethylmacrocin(1+) (CHEBI:76819) |
| Incoming Relation(s) |
| demethylmacrocin(1+) (CHEBI:76819) is conjugate acid of demethylmacrocin (CHEBI:15906) |
| Synonyms | Source |
|---|---|
| [(2R,3R,4E,6E,9R,11R,12S,13S,14R)-12-[3,6-dideoxy-4-O-(2,6-dideoxy-3-C-methyl-α-L-ribo-hexopyranosyl)-3-(dimethylamino)-β-D-glucopyranosyloxy]-2-ethyl-14-hydroxy-5,9,13-trimethyl-8,16-dioxo-11-(2-oxoethyl)oxacyclohexadeca-4,6-dien-3-yl]methyl 6-deoxy-β-D-allopyranoside | ChEBI |
| 2'''-O-Demethyllactenocin | KEGG COMPOUND |
| Demethylmacrocin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00018437 | KNApSAcK |
| C02400 | KEGG COMPOUND |
| DEMETHYLMACROCIN | MetaCyc |