EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O5 |
| Net Charge | 0 |
| Average Mass | 132.071 |
| Monoisotopic Mass | 132.00587 |
| SMILES | O=C(O)[C@@H]1O[C@H]1C(=O)O |
| InChI | InChI=1S/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2-/m1/s1 |
| InChIKey | DCEMCPAKSGRHCN-JCYAYHJZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2,3-epoxysuccinic acid (CHEBI:15900) has functional parent succinic acid (CHEBI:15741) |
| trans-2,3-epoxysuccinic acid (CHEBI:15900) is a C4-dicarboxylic acid (CHEBI:66873) |
| trans-2,3-epoxysuccinic acid (CHEBI:15900) is a epoxide (CHEBI:32955) |
| trans-2,3-epoxysuccinic acid (CHEBI:15900) is conjugate acid of trans-2,3-epoxysuccinate(2−) (CHEBI:57558) |
| Incoming Relation(s) |
| trans-2,3-epoxysuccinate(2−) (CHEBI:57558) is conjugate base of trans-2,3-epoxysuccinic acid (CHEBI:15900) |
| IUPAC Name |
|---|
| rel-(2R,3R)-oxirane-2,3-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| trans-2,3-epoxysuccinate | ChEBI |
| trans-2,3-Epoxysuccinate | KEGG COMPOUND |