EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13O9P |
| Net Charge | 0 |
| Average Mass | 260.135 |
| Monoisotopic Mass | 260.02972 |
| SMILES | O=C(CO)[C@H](O)[C@H](O)[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h4-7,9-11H,1-2H2,(H2,12,13,14)/t4-,5-,6+/m0/s1 |
| InChIKey | GSXOAOHZAIYLCY-HCWXCVPCSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-L-tagatose 6-phosphate (CHEBI:15845) is a L-tagatose 6-phosphate (CHEBI:13173) |
| keto-L-tagatose 6-phosphate (CHEBI:15845) is conjugate acid of keto-L-tagatose 6-phosphate(2−) (CHEBI:134284) |
| keto-L-tagatose 6-phosphate (CHEBI:15845) is enantiomer of keto-D-tagatose 6-phosphate (CHEBI:47947) |
| Incoming Relation(s) |
| keto-L-tagatose 6-phosphate(2−) (CHEBI:134284) is conjugate base of keto-L-tagatose 6-phosphate (CHEBI:15845) |
| keto-D-tagatose 6-phosphate (CHEBI:47947) is enantiomer of keto-L-tagatose 6-phosphate (CHEBI:15845) |
| IUPAC Names |
|---|
| keto-L-lyxo-hex-2-ulose 6-(dihydrogen phosphate) |
| keto-L-tagatose 6-(dihydrogen phosphate) |
| Synonym | Source |
|---|---|
| 6-O-phosphono-L-tagatose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| CPD-15828 | MetaCyc |