EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | CC(C)=CCCC(C)O |
| InChI | InChI=1S/C8H16O/c1-7(2)5-4-6-8(3)9/h5,8-9H,4,6H2,1-3H3 |
| InChIKey | OHEFFKYYKJVVOX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcatol (CHEBI:15833) has role pheromone (CHEBI:26013) |
| sulcatol (CHEBI:15833) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 6-methylhept-5-en-2-ol |
| Synonyms | Source |
|---|---|
| 6-methyl-5-hepten-2-ol | ChEBI |
| 6-Methyl-5-hepten-2-ol | KEGG COMPOUND |
| 6-methylhept-5-en-2-ol | ChEBI |
| 6-Methylhept-5-en-2-ol | KEGG COMPOUND |
| Sulcatol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| sulcatol | UniProt |
| Citations |
|---|